Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Benzimidazo[1,2-c]Quinazoline-6(5H)-Thione |
|---|---|
| Synonyms | Eu-0061205; Oprea1_053645; Zinc02168806 |
| Molecular Structure | ![CAS#: 24192-82-3， Benzimidazo[1,2-c]Quinazoline-6(5H)-Thione](/moreStructures/24192-82-3.gif) |
| Molecular Formula | C14H9N3S |
| Molecular Weight | 251.31 |
| CAS Registry Number | 24192-82-3 |
| EINECS | 246-071-3 |
| SMILES | C4=C3N1C(=C2C(=NC1=S)C=CC=C2)NC3=CC=C4 |
| InChI | 1S/C14H9N3S/c18-14-16-10-6-2-1-5-9(10)13-15-11-7-3-4-8-12(11)17(13)14/h1-8,15H |
| InChIKey | YZELHXRPSMWNIQ-UHFFFAOYSA-N |
| Density | 1.454g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.255°C at 760 mmHg (Cal.) |
| Flash point | 218.245°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzimidazo[1,2-c]Quinazoline-6(5H)-Thione |