|
CAS#: 24224-08-6 Product: Methyl 2-Chloropropanoylcarbamate No suppilers available for the product. |
| Name | Methyl 2-Chloropropanoylcarbamate |
|---|---|
| Synonyms | N-[(2S)-2-Chloro-1-Oxopropyl]Carbamic Acid Methyl Ester; N-[(2S)-2-Chloropropanoyl]Carbamic Acid Methyl Ester; Zinc04218345 |
| Molecular Structure | ![]() |
| Molecular Formula | C5H8ClNO3 |
| Molecular Weight | 165.58 |
| CAS Registry Number | 24224-08-6 |
| SMILES | [C@@H](Cl)(C(=O)NC(OC)=O)C |
| InChI | 1S/C5H8ClNO3/c1-3(6)4(8)7-5(9)10-2/h3H,1-2H3,(H,7,8,9)/t3-/m0/s1 |
| InChIKey | IARLQUFRBPPLKE-VKHMYHEASA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Methyl 2-Chloropropanoylcarbamate |