Online Database of Chemicals from Around the World
|
CAS#: 24225-69-2 Product: 3,9-Dibromo-9H-Fluorene No suppilers available for the product. |
| Name | 3,9-Dibromo-9H-Fluorene |
|---|---|
| Synonyms | Nsc90708; Nciopen2_009663 |
| Molecular Structure |  |
| Molecular Formula | C13H8Br2 |
| Molecular Weight | 324.01 |
| CAS Registry Number | 24225-69-2 |
| SMILES | C1=CC(=CC2=C1C(Br)C3=C2C=CC=C3)Br |
| InChI | 1S/C13H8Br2/c14-8-5-6-11-12(7-8)9-3-1-2-4-10(9)13(11)15/h1-7,13H |
| InChIKey | WGHDNGVTEYHDAO-UHFFFAOYSA-N |
| Density | 1.811g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.533°C at 760 mmHg (Cal.) |
| Flash point | 209.262°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,9-Dibromo-9H-Fluorene |