| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Name | 1-(2-Hydroxy-5-Methylphenyl)-2-Phenylethanone |
|---|---|
| Synonyms | 1-(2-hydroxy-5-methylphenyl)-2-phenylethan-1-one; 1-(2-Hydroxy-5-methylphenyl)-2-phenylethanone #; 2'-HYDROXY-5'-METHYL-2-PHENYLACETOPHENONE |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27 |
| CAS Registry Number | 24258-63-7 |
| SMILES | O=C(c1cc(ccc1O)C)Cc2ccccc2 |
| InChI | 1S/C15H14O2/c1-11-7-8-14(16)13(9-11)15(17)10-12-5-3-2-4-6-12/h2-9,16H,10H2,1H3 |
| InChIKey | LKOPRDNSXNVRPS-UHFFFAOYSA-N |
| Density | 1.152g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.467°C at 760 mmHg (Cal.) |
| Flash point | 157.671°C (Cal.) |
| Refractive index | 1.603 (Cal.) |
| (1) | C.-H. He, J.-P. Zhang and J.-G. Chang. 1-(2-Hydroxy-5-methylphenyl)-2-phenylethanone, Acta Cryst. (2007). E63, o3810 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(2-Hydroxy-5-Methylphenyl)-2-Phenylethanone |