Online Database of Chemicals from Around the World
|
CAS#: 24271-51-0 Product: 3-Methylphenyl Pentafluoropropanoate No suppilers available for the product. |
| Name | 3-Methylphenyl Pentafluoropropanoate |
|---|---|
| Synonyms | Pentafluoropropanoic acid 3-methylphenyl ester; Pentafluoropropanoic acid, 3-methylphenyl ester |
| Molecular Structure |  |
| Molecular Formula | C10H7F5O2 |
| Molecular Weight | 254.15 |
| CAS Registry Number | 24271-51-0 |
| SMILES | O=C(Oc1cc(ccc1)C)C(F)(F)C(F)(F)F |
| InChI | 1S/C10H7F5O2/c1-6-3-2-4-7(5-6)17-8(16)9(11,12)10(13,14)15/h2-5H,1H3 |
| InChIKey | VCFKKISUOVMLFT-UHFFFAOYSA-N |
| Density | 1.358g/cm3 (Cal.) |
|---|---|
| Boiling point | 185.83°C at 760 mmHg (Cal.) |
| Flash point | 69.955°C (Cal.) |
| Refractive index | 1.424 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methylphenyl Pentafluoropropanoate |