Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | 1-(4-Methylphenyl)-2-Phenylethane-1,2-Dione |
|---|---|
| Synonyms | 1-(4-Methylphenyl)-2-Phenyl-Ethane-1,2-Dione; P-Methylbenzil |
| Molecular Structure |  |
| Molecular Formula | C15H12O2 |
| Molecular Weight | 224.26 |
| CAS Registry Number | 2431-00-7 |
| EINECS | 219-396-3 |
| SMILES | C2=C(C(C(=O)C1=CC=CC=C1)=O)C=CC(=C2)C |
| InChI | 1S/C15H12O2/c1-11-7-9-13(10-8-11)15(17)14(16)12-5-3-2-4-6-12/h2-10H,1H3 |
| InChIKey | QKFICTUTRIMBEX-UHFFFAOYSA-N |
| Density | 1.14g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.222°C at 760 mmHg (Cal.) |
| Flash point | 156.018°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(4-Methylphenyl)-2-Phenylethane-1,2-Dione |