Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 2,7-Difluorofluoren-9-One |
|---|---|
| Synonyms | 2,7-Difluoro-9-Fluorenone; Nsc98102; Nciopen2_006280 |
| Molecular Structure |  |
| Molecular Formula | C13H6F2O |
| Molecular Weight | 216.19 |
| CAS Registry Number | 24313-53-9 |
| SMILES | C1=C3C(=CC=C1F)C2=CC=C(C=C2C3=O)F |
| InChI | 1S/C13H6F2O/c14-7-1-3-9-10-4-2-8(15)6-12(10)13(16)11(9)5-7/h1-6H |
| InChIKey | VEOGWHFDYPRACH-UHFFFAOYSA-N |
| Density | 1.411g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.661°C at 760 mmHg (Cal.) |
| Flash point | 135.394°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,7-Difluorofluoren-9-One |