|
CAS#: 24315-83-1 Product: Pentapotassium Pentasodium Bis(Triphosphate) No suppilers available for the product. |
| Name | Pentapotassium Pentasodium Bis(Triphosphate) |
|---|---|
| Synonyms | C03279; P3,I; P3i |
| Molecular Structure | ![]() |
| Molecular Formula | H5O10P3 |
| Molecular Weight | 257.95 |
| CAS Registry Number | 24315-83-1 |
| EINECS | 246-156-5 |
| SMILES | O=[P](O)(O[P](=O)(O)O[P](=O)(O)O)O |
| InChI | 1S/H5O10P3/c1-11(2,3)9-13(7,8)10-12(4,5)6/h(H,7,8)(H2,1,2,3)(H2,4,5,6) |
| InChIKey | UNXRWKVEANCORM-UHFFFAOYSA-N |
| Density | 2.548g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Pentapotassium Pentasodium Bis(Triphosphate) |