Online Database of Chemicals from Around the World
|
CAS#: 2433-20-7 Product: N,N-Diethyl-3,5-Dimethyl-1,2-Oxazole-4-Carboxamide No suppilers available for the product. |
| Name | N,N-Diethyl-3,5-Dimethyl-1,2-Oxazole-4-Carboxamide |
|---|---|
| Synonyms | N,N-Diethyl-3,5-Dimethyl-Isoxazole-4-Carboxamide; N,N-Diethyl-3,5-Dimethyl-4-Isoxazolecarboxamide; Cycliton |
| Molecular Structure |  |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 |
| CAS Registry Number | 2433-20-7 |
| SMILES | C(C)N(CC)C(=O)C1=C(ON=C1C)C |
| InChI | 1S/C10H16N2O2/c1-5-12(6-2)10(13)9-7(3)11-14-8(9)4/h5-6H2,1-4H3 |
| InChIKey | NFALFEDRJGVKNY-UHFFFAOYSA-N |
| Density | 1.053g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.983°C at 760 mmHg (Cal.) |
| Flash point | 167.278°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Diethyl-3,5-Dimethyl-1,2-Oxazole-4-Carboxamide |