Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 5,6-Bis(Methylsulfonyloxymethyl)Bicyclo[2.2.1]Hept-2-Ene |
|---|---|
| Synonyms | Methanesulfonic Acid [6-(Methylsulfonyloxymethyl)-5-Bicyclo[2.2.1]Hept-2-Enyl]Methyl Ester; Nciopen2_008979; Nsc54688 |
| Molecular Structure | ![CAS#: 2434-87-9， 5,6-Bis(Methylsulfonyloxymethyl)Bicyclo[2.2.1]Hept-2-Ene](/moreStructures/2434-87-9.gif) |
| Molecular Formula | C11H18O6S2 |
| Molecular Weight | 310.38 |
| CAS Registry Number | 2434-87-9 |
| SMILES | C(O[S](=O)(=O)C)C1C2CC(C1CO[S](=O)(=O)C)C=C2 |
| InChI | 1S/C11H18O6S2/c1-18(12,13)16-6-10-8-3-4-9(5-8)11(10)7-17-19(2,14)15/h3-4,8-11H,5-7H2,1-2H3 |
| InChIKey | APMIZYLSEZLHRJ-UHFFFAOYSA-N |
| Density | 1.359g/cm3 (Cal.) |
|---|---|
| Boiling point | 516.198°C at 760 mmHg (Cal.) |
| Flash point | 265.987°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Bis(Methylsulfonyloxymethyl)Bicyclo[2.2.1]Hept-2-Ene |