Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | N,N-Dimethylnaphthalen-2-Amine |
|---|---|
| Synonyms | N,N-Dimethyl-2-Naphthalenamine; Dimethyl-(2-Naphthyl)Amine; 2-Naphthalenamine, N,N-Dimethyl- |
| Molecular Structure |  |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 |
| CAS Registry Number | 2436-85-3 |
| EINECS | 219-432-8 |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2)N(C)C |
| InChI | 1S/C12H13N/c1-13(2)12-8-7-10-5-3-4-6-11(10)9-12/h3-9H,1-2H3 |
| InChIKey | IKZPRXHVTFNIEK-UHFFFAOYSA-N |
| Density | 1.06g/cm3 (Cal.) |
|---|---|
| Melting point | 46°C (Expl.) |
| Boiling point | 303.136°C at 760 mmHg (Cal.) |
| Flash point | 123.447°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethylnaphthalen-2-Amine |