Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-[(2S,5S)-2,5-Dimethylcyclopentyl]Ethanone |
|---|---|
| Synonyms | 1-((2S,5S)-2,5-dimethylcyclopentyl)ethanone |
| Molecular Structure | ![CAS#: 243672-12-0， 1-[(2S,5S)-2,5-Dimethylcyclopentyl]Ethanone](/moreStructures/243672-12-0.gif) |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.22 |
| CAS Registry Number | 243672-12-0 |
| SMILES | C[C@H]1CC[C@@H](C1C(=O)C)C |
| InChI | 1S/C9H16O/c1-6-4-5-7(2)9(6)8(3)10/h6-7,9H,4-5H2,1-3H3/t6-,7-/m0/s1 |
| InChIKey | NZSONUYAPMMHBX-BQBZGAKWSA-N |
| Density | 0.877g/cm3 (Cal.) |
|---|---|
| Boiling point | 187.321°C at 760 mmHg (Cal.) |
| Flash point | 69.853°C (Cal.) |
| Refractive index | 1.434 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(2S,5S)-2,5-Dimethylcyclopentyl]Ethanone |