Online Database of Chemicals from Around the World
|
CAS#: 24416-64-6 Product: 4-Methyl-4',5'-Dihydropsoralen No suppilers available for the product. |
| Name | 4-Methyl-4',5'-Dihydropsoralen |
|---|---|
| Synonyms | 4-Methyl-4',5'-Dihydropsoralen; 7H-Furo(3,2-G)(1)Benzopyran-7-One, 2,3-Dihydro-5-Methyl- |
| Molecular Structure |  |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.21 |
| CAS Registry Number | 24416-64-6 |
| SMILES | C1=C3C(=CC2=C1C(=CC(O2)=O)C)OCC3 |
| InChI | 1S/C12H10O3/c1-7-4-12(13)15-11-6-10-8(2-3-14-10)5-9(7)11/h4-6H,2-3H2,1H3 |
| InChIKey | ZQFUVTUXUFYERW-UHFFFAOYSA-N |
| Density | 1.303g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.008°C at 760 mmHg (Cal.) |
| Flash point | 156.382°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-4',5'-Dihydropsoralen |