Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | N'-Acetyl-2-Chloro-5-Nitrobenzohydrazide |
|---|---|
| Synonyms | BENZOIC ACID,2-CHLORO-5-NITRO-, 2-ACETYLHYDRAZIDE; N'1-acetyl-2-chloro-5-nitrobenzene-1-carbohydrazide; ZINC00153170 |
| Molecular Structure |  |
| Molecular Formula | C9H8ClN3O4 |
| Molecular Weight | 257.63 |
| CAS Registry Number | 244167-73-5 |
| SMILES | O=C(c1cc(ccc1Cl)[N+]([O-])=O)NNC(=O)C |
| InChI | 1S/C9H8ClN3O4/c1-5(14)11-12-9(15)7-4-6(13(16)17)2-3-8(7)10/h2-4H,1H3,(H,11,14)(H,12,15) |
| InChIKey | UIOJAVUNWYUVOQ-UHFFFAOYSA-N |
| Density | 1.464g/cm3 (Cal.) |
|---|---|
| Boiling point | 544.608°C at 760 mmHg (Cal.) |
| Flash point | 283.169°C (Cal.) |
| Refractive index | 1.592 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N'-Acetyl-2-Chloro-5-Nitrobenzohydrazide |