Online Database of Chemicals from Around the World
| Name | 2-Chloro-9H-Fluorene-9-Carboxylic Acid |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C14H9ClO2 |
| Molecular Weight | 244.67 |
| CAS Registry Number | 24539-66-0 |
| SMILES | OC(=O)C3c1ccccc1c2ccc(Cl)cc23 |
| InChI | 1S/C14H9ClO2/c15-8-5-6-10-9-3-1-2-4-11(9)13(14(16)17)12(10)7-8/h1-7,13H,(H,16,17) |
| InChIKey | GJGFCWCPVQHXMF-UHFFFAOYSA-N |
| Density | 1.418g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.404°C at 760 mmHg (Cal.) |
| Flash point | 223.778°C (Cal.) |
| Refractive index | 1.674 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-9H-Fluorene-9-Carboxylic Acid |
