|
CAS#: 24550-32-1 Product: trans-3-Benzyloxy-trans-beta-Nitrostyrene No suppilers available for the product. |
| Name | trans-3-Benzyloxy-trans-beta-Nitrostyrene |
|---|---|
| Synonyms | 1-[(Z)-2-Nitrovinyl]-3-(Phenylmethoxy)Benzene; 1-(Benzyloxy)-3-[(Z)-2-Nitrovinyl]Benzene; Zinc04701637 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 |
| CAS Registry Number | 24550-32-1 |
| SMILES | C1=C(C=CC=C1OCC2=CC=CC=C2)\C=C/[N+]([O-])=O |
| InChI | 1S/C15H13NO3/c17-16(18)10-9-13-7-4-8-15(11-13)19-12-14-5-2-1-3-6-14/h1-11H,12H2/b10-9- |
| InChIKey | XFBMDILDMJAPDU-KTKRTIGZSA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.789°C at 760 mmHg (Cal.) |
| Flash point | 182.344°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for trans-3-Benzyloxy-trans-beta-Nitrostyrene |