Online Database of Chemicals from Around the World
|
CAS#: 24585-99-7 Product: 1-(4-Phenethylphenyl)Glyoxal No suppilers available for the product. |
| Name | 1-(4-Phenethylphenyl)Glyoxal |
|---|---|
| Synonyms | 2-Keto-2-[4-(2-Phenylethyl)Phenyl]Acetaldehyde; 2-Oxo-2-[4-(2-Phenylethyl)Phenyl]Ethanal; Glyoxal, (P-Phenethylphenyl)- |
| Molecular Structure |  |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 |
| CAS Registry Number | 24585-99-7 |
| SMILES | C1=C(C(C=O)=O)C=CC(=C1)CCC2=CC=CC=C2 |
| InChI | 1S/C16H14O2/c17-12-16(18)15-10-8-14(9-11-15)7-6-13-4-2-1-3-5-13/h1-5,8-12H,6-7H2 |
| InChIKey | YEWSCLFUUYUKAE-UHFFFAOYSA-N |
| Density | 1.125g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.147°C at 760 mmHg (Cal.) |
| Flash point | 144.609°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Phenethylphenyl)Glyoxal |