Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Dimethyl [[(1-Oxoallyl)Amino]Methyl]Phosphonate |
|---|---|
| Synonyms | N-(Dimethoxyphosphorylmethyl)Acrylamide; Dimethyl (((1-Oxoallyl)Amino)Methyl)Phosphonate |
| Molecular Structure | ![CAS#: 24610-95-5， Dimethyl [[(1-Oxoallyl)Amino]Methyl]Phosphonate](/moreStructures/24610-95-5.gif) |
| Molecular Formula | C6H12NO4P |
| Molecular Weight | 193.14 |
| CAS Registry Number | 24610-95-5 |
| EINECS | 246-353-6 |
| SMILES | C([P](=O)(OC)OC)NC(C=C)=O |
| InChI | 1S/C6H12NO4P/c1-4-6(8)7-5-12(9,10-2)11-3/h4H,1,5H2,2-3H3,(H,7,8) |
| InChIKey | OLKYWAGUBPTLHH-UHFFFAOYSA-N |
| Density | 1.167g/cm3 (Cal.) |
|---|---|
| Boiling point | 355.651°C at 760 mmHg (Cal.) |
| Flash point | 168.892°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl [[(1-Oxoallyl)Amino]Methyl]Phosphonate |