Online Database of Chemicals from Around the World
|
CAS#: 24700-20-7 Product: p-Tolyl 3-Methylcrotonate No suppilers available for the product. |
| Name | p-Tolyl 3-Methylcrotonate |
|---|---|
| Synonyms | 3-Methylbut-2-Enoic Acid (4-Methylphenyl) Ester; P-Tolyl 3-Methylcrotonate; 2-Butenoic Acid, 3-Methyl-, 4-Methylphenyl Ester |
| Molecular Structure |  |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 |
| CAS Registry Number | 24700-20-7 |
| EINECS | 246-422-0 |
| SMILES | C1=C(C=CC(=C1)OC(=O)C=C(C)C)C |
| InChI | 1S/C12H14O2/c1-9(2)8-12(13)14-11-6-4-10(3)5-7-11/h4-8H,1-3H3 |
| InChIKey | WXLMUDDKYMGUFP-UHFFFAOYSA-N |
| Density | 1.021g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.409°C at 760 mmHg (Cal.) |
| Flash point | 117.969°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for p-Tolyl 3-Methylcrotonate |