Online Database of Chemicals from Around the World

N-(2-(6-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-5-methoxyphenyl)acetamide
[CAS 2477812-38-5]

List of Suppliers
Sichuan Taienkang Pharmaceutical Co., Ltd. China
www.taienkangpharma.com
+86 15102825326
sales@taienkangpharma.com
QQ Chat
Skype Chat
Chemical manufacturer since 2020
chemBlink Standard supplier since 2024

Identification
ClassificationChemical reagent >> Organic reagent >> Amide
NameN-(2-(6-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-5-methoxyphenyl)acetamide
Molecular StructureN-(2-(6-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-5-methoxyphenyl)acetamide molecular structure (CAS 2477812-38-5)
Molecular FormulaC19H21NO3
Molecular Weight311.37
CAS Registry Number2477812-38-5
SMILESC1=CC(=CC2=C1CC(CC2)C3=CC=C(C=C3NC(C)=O)OC)O
Properties
Density1.216±0.40 g/cm3, Calc.*
Boiling Point523.9±50.0 °C, Calc.*
*Calculated using Advanced Chemistry Development (ACD/Labs) Software.
up Discovery and Applications
N-(2-(6-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-5-methoxyphenyl)acetamide is a compound that has gained attention in the fields of medicinal and organic chemistry due to its unique structure and potential pharmacological properties. The molecule features a naphthalene-derived structure fused with a methoxyphenyl group and an acetamide moiety, offering a combination of hydrophobic and polar functional groups that may interact with various biological targets. The hydroxyl group on the tetrahydronaphthalene ring and the methoxy group on the phenyl ring contribute to the compound's potential bioactivity and chemical reactivity.

The discovery of N-(2-(6-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-5-methoxyphenyl)acetamide can be attributed to ongoing efforts in the synthesis of compounds that exhibit potential therapeutic effects by modulating neurotransmitter systems or other biological pathways. The tetrahydronaphthalene core is of particular interest in drug design due to its structural similarity to known biologically active molecules, suggesting that modifications to this scaffold could lead to compounds with desirable pharmacological properties. The presence of the methoxyphenyl and acetamide functional groups adds further versatility to the compound, allowing for interactions with a variety of molecular targets, such as enzymes, receptors, or transporters.

The synthesis of N-(2-(6-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-5-methoxyphenyl)acetamide typically involves the formation of the naphthalene ring system, followed by the selective attachment of the methoxyphenyl group and acetamide moiety. The synthetic process requires careful control of reaction conditions to ensure the desired functionalization and stereochemistry of the final product. The hydroxyl and methoxy groups are introduced in a way that enhances the compound's solubility and stability, which are critical factors for its potential use in biological applications.

In terms of application, this compound holds promise as a lead structure for the development of new pharmaceuticals targeting central nervous system disorders, inflammation, or other diseases where modulation of specific biological pathways is needed. The tetrahydronaphthalene scaffold suggests potential activity in modulating dopaminergic or serotonergic systems, which are involved in conditions such as depression, anxiety, or Parkinson’s disease. Additionally, the acetamide group may contribute to the compound’s ability to interact with enzymes or receptors involved in pain, inflammation, or cancer.

The ability of N-(2-(6-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-5-methoxyphenyl)acetamide to interact with multiple biological targets makes it a versatile candidate for further investigation in drug development. Research is ongoing to explore its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion, as well as its efficacy in preclinical models of disease. The compound’s unique structure provides a foundation for the development of derivatives with improved selectivity and potency, potentially leading to new treatments for a variety of health conditions.
Market Analysis Reports
Related Products
4-Hydroxytetrah...  30-Hydroxy-5-(T...  4-[(1-Hydroxy5,...  7-Hydroxy-1,2,3...  6-Hydroxy-1,2,3...  6-Hydroxy-1,2,3...  ((1S,4S)-4-Hydr...  1-(3-Hydroxy-5,...  1-(1-Hydroxy-5,...  (E)-N-Hydroxy-1...  (2-Hydroxy-1,2,...  (1S,2S)-trans-1...  (1R,2R)-trans-1...  N-(3-Hydroxy-1,...  3-Hydroxy-4,5,6...  (8R,8aS)-8-Hydr...  (8S,8aS)-8-Hydr...  3-Hydroxy-N-(te...  3-Hydroxy-N-(te...  (3S,3aR,6aS)-3-...