| Zhejiang Chempharm Industry&trading Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.chempharm.cn | |||
![]() | +86 (571) 8770-1568 | |||
![]() | export@chempharm.cn | |||
| Chemical distributor since 1996 | ||||
| chemBlink Standard supplier since 2007 | ||||
| Name | N-Ethyl-2-(4-formylphenyl)acetamide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 |
| CAS Registry Number | 2477812-42-1 |
| SMILES | O=C(NCC)CC1=CC=C(C=O)C=C1 |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319 Details |
| Safety Statements | P501-P270-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330 Details |
| SDS | Available |
|
N-ethyl-2-(4-formylphenyl)acetamide is an organic compound with potential applications in pharmaceuticals, chemical research, and materials science. The discovery of N-ethyl-2-(4-formylphenyl)acetamide is part of a broad effort to synthesize compounds with specific pharmacological properties. Researchers focus on modifying acetamide derivatives to develop molecules with higher efficacy and fewer side effects. The introduction of formyl groups to the benzene ring and ethyl groups to the acetamide moiety is intended to enhance the stability and biological activity of the compound. The synthesis of this compound involves advanced organic chemistry techniques that allow for precise incorporation of functional groups to achieve the desired structure and properties. N-ethyl-2-(4-formylphenyl)acetamide has several key properties and has a molecular formula of C11H13NO2 and a molecular weight of 191.23 g/mol. The compound has an acetamide group bonded to an ethyl group and a benzene ring substituted with a formyl group in the para position. These structural features contribute to the stability, solubility, and reactivity of the compound, making it suitable for a variety of applications in research and industry. The main application of N-ethyl-2-(4-formylphenyl)acetamide is pharmaceuticals. Its structure suggests that it could be used as a building block for the synthesis of various drugs. The formyl group can be further modified to produce derivatives with enhanced pharmacological activity. Studies have shown that this compound could be used as an intermediate for drugs to treat neurological diseases, inflammation, and infection. In chemical research, N-ethyl-2-(4-formylphenyl)acetamide is a valuable reagent and intermediate. It is able to undergo various chemical reactions, such as condensation and reduction, and can therefore be used to synthesize more complex molecules. Researchers use this compound to explore new synthetic pathways and develop innovative chemical processes. Its reactivity and stability allow for the creation of novel compounds with potential applications in multiple scientific fields. The unique structural features of this compound also make it relevant to materials science. It can be added to polymers and other materials to enhance their properties. For example, N-ethyl-2-(4-formylphenyl)acetamide can be used to modify the physical and chemical properties of polymers, improving their strength, flexibility, and thermal stability. These enhanced materials can be used in various industries such as automotive, aerospace, and electronics. The compound's potential extends to the agricultural sector, where it can be used as a precursor for the synthesis of agrochemicals. These agrochemicals include herbicides, insecticides, and fungicides that protect crops from pests and diseases. The ability to modify the formyl and ethyl groups allows for the development of compounds with specific insecticidal activity, thus contributing to more efficient and environmentally friendly agricultural practices. The future of N-ethyl-2-(4-formylphenyl)acetamide lies in continued exploration through research and development. Understanding its full biological activity, chemical reactivity, and material-enhancing properties is essential for its further application. Innovations in synthetic methods and derivative development are expected to improve its efficacy and expand its application in various fields. References none |
| Market Analysis Reports |