Online Database of Chemicals from Around the World
|
CAS#: 24779-38-2 Product: (2R,5S)-rel-(+)-1,2,5-Trimethyl-4-[(2E,4E)-1-oxo-2,4-hexadienyl]-Piperazine No suppilers available for the product. |
| Name | (2R,5S)-rel-(+)-1,2,5-Trimethyl-4-[(2E,4E)-1-oxo-2,4-hexadienyl]-Piperazine |
|---|---|
| Synonyms | (2E,4E)-1-[(2S,5R)-2,4,5-Trimethyl-1-Piperazinyl]Hexa-2,4-Dien-1-One |
| Molecular Structure | ![CAS#: 24779-38-2， (2R,5S)-rel-(+)-1,2,5-Trimethyl-4-[(2E,4E)-1-oxo-2,4-hexadienyl]-Piperazine](/moreStructures/24779-38-2.gif) |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 |
| CAS Registry Number | 24779-38-2 |
| SMILES | [C@H]1(N(C[C@H](N(C1)C)C)C(=O)\C=C\C=C\C)C |
| InChI | 1S/C13H22N2O/c1-5-6-7-8-13(16)15-10-11(2)14(4)9-12(15)3/h5-8,11-12H,9-10H2,1-4H3/b6-5+,8-7+/t11-,12+/m1/s1 |
| InChIKey | DVCNHRTYSUTLOS-JBPJPUBUSA-N |
| Density | 0.954g/cm3 (Cal.) |
|---|---|
| Boiling point | 354.669°C at 760 mmHg (Cal.) |
| Flash point | 145.859°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R,5S)-rel-(+)-1,2,5-Trimethyl-4-[(2E,4E)-1-oxo-2,4-hexadienyl]-Piperazine |