Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (732) 355-9920 | |||
|
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 2,4-Dinitro-1-(2-Phenylethenyl)Benzene |
|---|---|
| Synonyms | 2,4-Dinitro-1-[(E)-2-Phenylethenyl]Benzene; 2,4-Dinitro-1-(2-Phenylvinyl)Benzene; 2,4-Dinitro-1-[(E)-2-Phenylvinyl]Benzene |
| Molecular Structure |  |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 |
| CAS Registry Number | 2486-13-7 |
| EINECS | 219-628-3 |
| SMILES | C1=CC(=CC(=C1\C=C\C2=CC=CC=C2)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | 1S/C14H10N2O4/c17-15(18)13-9-8-12(14(10-13)16(19)20)7-6-11-4-2-1-3-5-11/h1-10H/b7-6+ |
| InChIKey | YHUVJTKXOKHAQP-VOTSOKGWSA-N |
| Density | 1.376g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.44°C at 760 mmHg (Cal.) |
| Flash point | 188.755°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,4-Dinitro-1-(2-Phenylethenyl)Benzene |