Online Database of Chemicals from Around the World
|
CAS#: 2486-93-3 Product: 1-(Aziridin-1-Yl-Butoxyphosphoryl)Aziridine No suppilers available for the product. |
| Name | 1-(Aziridin-1-Yl-Butoxyphosphoryl)Aziridine |
|---|---|
| Synonyms | 1-(Aziridin-1-Yl-Butoxy-Phosphoryl)Aziridine; 1-(1-Aziridinyl-Butoxyphosphoryl)Aziridine; 1-(Butoxy-Ethylenimino-Phosphoryl)Ethylenimine |
| Molecular Structure |  |
| Molecular Formula | C8H17N2O2P |
| Molecular Weight | 204.21 |
| CAS Registry Number | 2486-93-3 |
| SMILES | C(O[P](N1CC1)(N2CC2)=O)CCC |
| InChI | 1S/C8H17N2O2P/c1-2-3-8-12-13(11,9-4-5-9)10-6-7-10/h2-8H2,1H3 |
| InChIKey | RYRMQIBBMYEHMM-UHFFFAOYSA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Boiling point | 268.039°C at 760 mmHg (Cal.) |
| Flash point | 115.906°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Aziridin-1-Yl-Butoxyphosphoryl)Aziridine |