| Acorn PharmaTech, LLC | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 353-2487 | |||
![]() |
sales@acornpharmatech.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Quality Phytochemicals LLC | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (908) 510-9277 | |||
![]() |
sales@qualityphytochemicalsllc.com | |||
| Chemical manufacturer | ||||
| Name | Mesembrine Extract |
|---|---|
| Synonyms | C09224; Mesembrine; Nci60_034735 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 |
| CAS Registry Number | 24880-43-1 |
| SMILES | [C@]12([C@@H](N(C)CC1)CC(CC2)=O)C3=CC(=C(C=C3)OC)OC |
| InChI | 1S/C17H23NO3/c1-18-9-8-17(7-6-13(19)11-16(17)18)12-4-5-14(20-2)15(10-12)21-3/h4-5,10,16H,6-9,11H2,1-3H3/t16-,17-/m0/s1 |
| InChIKey | DAHIQPJTGIHDGO-IRXDYDNUSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.2±45.0°C at 760 mmHg (Cal.) |
| Flash point | 207.3±28.7°C (Cal.) |
| (1) | Qing Gu and Shu-Li You. Desymmetrization of cyclohexadienones via cinchonine derived thiourea-catalyzed enantioselective aza-Michael reaction and total synthesis of (-)-Mesembrine, Chem. Sci., 2011, 2, 1519. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Mesembrine Extract |