Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | N-(4-Bromobenzyl)-1-(4-Bromophenyl)Methanamine |
|---|---|
| Synonyms | N,N-Bis(4-bromobenzyl)amine |
| Molecular Structure |  |
| Molecular Formula | C14H13Br2N |
| Molecular Weight | 355.07 |
| CAS Registry Number | 24898-17-7 |
| SMILES | Brc1ccc(cc1)CNCc2ccc(Br)cc2 |
| InChI | 1S/C14H13Br2N/c15-13-5-1-11(2-6-13)9-17-10-12-3-7-14(16)8-4-12/h1-8,17H,9-10H2 |
| InChIKey | DNHBOKSBUKGKMI-UHFFFAOYSA-N |
| Density | 1.584g/cm3 (Cal.) |
|---|---|
| Melting point | 51°C (Expl.) |
| Boiling point | 409.227°C at 760 mmHg (Cal.) |
| Flash point | 201.294°C (Cal.) |
| Refractive index | 1.625 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(4-Bromobenzyl)-1-(4-Bromophenyl)Methanamine |