Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 4-(4-Chlorophenyl)Diazenyl-N,N-Dimethylaniline |
|---|---|
| Synonyms | 4-(4-Chlorophenyl)Azo-N,N-Dimethyl-Aniline; 4-(4-Chlorophenyl)Azo-N,N-Dimethylaniline; [4-(4-Chlorophenyl)Azophenyl]-Dimethyl-Amine |
| Molecular Structure |  |
| Molecular Formula | C14H14ClN3 |
| Molecular Weight | 259.74 |
| CAS Registry Number | 2491-76-1 |
| SMILES | C1=C(C=CC(=C1)N(C)C)N=NC2=CC=C(Cl)C=C2 |
| InChI | 1S/C14H14ClN3/c1-18(2)14-9-7-13(8-10-14)17-16-12-5-3-11(15)4-6-12/h3-10H,1-2H3 |
| InChIKey | WQWHNMIYCHFRJK-UHFFFAOYSA-N |
| Density | 1.135g/cm3 (Cal.) |
|---|---|
| Melting point | 159°C (Expl.) |
| Boiling point | 404.186°C at 760 mmHg (Cal.) |
| Flash point | 198.245°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-(4-Chlorophenyl)Diazenyl-N,N-Dimethylaniline |