Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | (1R,2R)-Rel-2-(Aminomethyl)-Cyclohexanol Hydrochloride |
|---|---|
| Synonyms | [(1S,2S)-2-Hydroxycyclohexyl]Methylammonium; Zinc02516847 |
| Molecular Structure |  |
| Molecular Formula | C7H16NO |
| Molecular Weight | 130.21 |
| CAS Registry Number | 24947-68-0 |
| SMILES | [C@@H]1([C@@H](O)CCCC1)C[NH3+] |
| InChI | 1S/C7H15NO/c8-5-6-3-1-2-4-7(6)9/h6-7,9H,1-5,8H2/p+1/t6-,7-/m0/s1 |
| InChIKey | JGKFBZBVCAWDFD-BQBZGAKWSA-O |
| Boiling point | 226.424°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 90.738°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (1R,2R)-Rel-2-(Aminomethyl)-Cyclohexanol Hydrochloride |