|
CAS#: 2496-92-6 Product: 1-(Ethoxy-(2-Ethylsulfinylethylsulfanyl)Phosphoryl)Oxyethane No suppilers available for the product. |
| Name | 1-(Ethoxy-(2-Ethylsulfinylethylsulfanyl)Phosphoryl)Oxyethane |
|---|---|
| Synonyms | 1-[Ethoxy-(2-Ethylsulfinylethylthio)Phosphoryl]Oxyethane; Isosystox Sulfoxide; O,O-Diethyl S-(2-Eththionylethyl) Phosphorothioate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H19O4PS2 |
| Molecular Weight | 274.33 |
| CAS Registry Number | 2496-92-6 |
| SMILES | C(O[P](SCC[S](=O)CC)(=O)OCC)C |
| InChI | 1S/C8H19O4PS2/c1-4-11-13(9,12-5-2)14-7-8-15(10)6-3/h4-8H2,1-3H3 |
| InChIKey | RWRHZQVSYSDUSM-UHFFFAOYSA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 401.414°C at 760 mmHg (Cal.) |
| Flash point | 196.568°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Ethoxy-(2-Ethylsulfinylethylsulfanyl)Phosphoryl)Oxyethane |