Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-Iodo-Phenol 1-(4-Methylbenzenesulfonate) |
|---|---|
| Synonyms | 4-Methylbenzenesulfonic Acid (4-Iodophenyl) Ester; Nsc173913 |
| Molecular Structure |  |
| Molecular Formula | C13H11IO3S |
| Molecular Weight | 374.19 |
| CAS Registry Number | 24962-55-8 |
| SMILES | C2=C([S](OC1=CC=C(I)C=C1)(=O)=O)C=CC(=C2)C |
| InChI | 1S/C13H11IO3S/c1-10-2-8-13(9-3-10)18(15,16)17-12-6-4-11(14)5-7-12/h2-9H,1H3 |
| InChIKey | DDXDGBOZDFYVGL-UHFFFAOYSA-N |
| Density | 1.69g/cm3 (Cal.) |
|---|---|
| Boiling point | 445.635°C at 760 mmHg (Cal.) |
| Flash point | 223.312°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Iodo-Phenol 1-(4-Methylbenzenesulfonate) |