Online Database of Chemicals from Around the World
| AccuStandard Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (203) 786-5290 | |||
 |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 3-Methyl-Benz[a]Anthracene |
|---|---|
| Synonyms | 3-Methyl-1,2-Benzanthracene; 3-Methylbenz(A)Anthracene; Benz(A)Anthracene, 3-Methyl- |
| Molecular Structure | ![CAS#: 2498-75-1， 3-Methyl-Benz[a]Anthracene](/moreStructures/2498-75-1.gif) |
| Molecular Formula | C19H14 |
| Molecular Weight | 242.32 |
| CAS Registry Number | 2498-75-1 |
| SMILES | C1=C(C)C=CC2=C1C=CC3=C2C=C4C(=C3)C=CC=C4 |
| InChI | 1S/C19H14/c1-13-6-9-18-16(10-13)7-8-17-11-14-4-2-3-5-15(14)12-19(17)18/h2-12H,1H3 |
| InChIKey | VYZKVUIQCRWXJH-UHFFFAOYSA-N |
| Density | 1.165g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.425°C at 760 mmHg (Cal.) |
| Flash point | 217.844°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-Benz[a]Anthracene |