Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | Ethyl 2-(1-Methylindol-3-Yl)-2-Oxo-Acetate |
|---|---|
| Synonyms | Ethyl 2-(1-Methylindol-3-Yl)-2-Oxo-Acetate; 2-(1-Methyl-3-Indolyl)-2-Oxoacetic Acid Ethyl Ester; 2-Keto-2-(1-Methylindol-3-Yl)Acetic Acid Ethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 |
| CAS Registry Number | 25055-54-3 |
| SMILES | C2=C(C1=CC=CC=C1[N]2C)C(=O)C(=O)OCC |
| InChI | 1S/C13H13NO3/c1-3-17-13(16)12(15)10-8-14(2)11-7-5-4-6-9(10)11/h4-8H,3H2,1-2H3 |
| InChIKey | DFLGCVGOABTHCE-UHFFFAOYSA-N |
| Density | 1.186g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.157°C at 760 mmHg (Cal.) |
| Flash point | 184.317°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-(1-Methylindol-3-Yl)-2-Oxo-Acetate |