| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 2,3,4,5,5,5-Hexafluoro-2,4-Bis(Trifluoromethyl)-1-Pentanol |
|---|---|
| Synonyms | 1H,1H,3H-Perfluoro(2,4-dimethylpentan-1-ol); 1H,1H,3H-Perfluoro(2,4-dimethylpentane-1-ol); 2,3,4,5,5,5-Hexafluoro-2,4-bis(trifluoromethyl)pentan-1-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C7H4F12O |
| Molecular Weight | 332.09 |
| CAS Registry Number | 25065-50-3 |
| SMILES | FC(F)(F)C(F)(C(F)C(F)(C(F)(F)F)C(F)(F)F)CO |
| InChI | 1S/C7H4F12O/c8-2(3(9,1-20)5(11,12)13)4(10,6(14,15)16)7(17,18)19/h2,20H,1H2 |
| InChIKey | PCGUNVYNJIFBQT-UHFFFAOYSA-N |
| Density | 1.6g/cm3 (Cal.) |
|---|---|
| Boiling point | 139.585°C at 760 mmHg (Cal.) |
| Flash point | 38.22°C (Cal.) |
| Refractive index | 1.291 (Cal.) |
| Safety Description | S23,S24/25,S36/37/39,S45 |
|---|---|
| R36/37/38 | |
| Irritant | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2,3,4,5,5,5-Hexafluoro-2,4-Bis(Trifluoromethyl)-1-Pentanol |