Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Hydroxy-2-[2-(Trifluoromethyl)Phenyl]Acetamide |
|---|---|
| Synonyms | 2-hydroxy-2-(2-(trifluoromethyl)phenyl)acetamide |
| Molecular Structure | ![CAS#: 251366-94-6， 2-Hydroxy-2-[2-(Trifluoromethyl)Phenyl]Acetamide](/moreStructures/251366-94-6.gif) |
| Molecular Formula | C9H8F3NO2 |
| Molecular Weight | 219.16 |
| CAS Registry Number | 251366-94-6 |
| SMILES | FC(F)(F)c1ccccc1C(O)C(N)=O |
| InChI | 1S/C9H8F3NO2/c10-9(11,12)6-4-2-1-3-5(6)7(14)8(13)15/h1-4,7,14H,(H2,13,15) |
| InChIKey | XLGZZMOEBIOKLH-UHFFFAOYSA-N |
| Density | 1.416g/cm3 (Cal.) |
|---|---|
| Boiling point | 335.774°C at 760 mmHg (Cal.) |
| Flash point | 156.871°C (Cal.) |
| Refractive index | 1.504 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Hydroxy-2-[2-(Trifluoromethyl)Phenyl]Acetamide |