Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-[2-Fluoro-6-(Trifluoromethyl)Phenyl]-2-Hydroxyacetamide |
|---|---|
| Synonyms | 2-(2-fluoro-6-(trifluoromethyl)phenyl)-2-hydroxyacetamide |
| Molecular Structure | ![CAS#: 251366-95-7， 2-[2-Fluoro-6-(Trifluoromethyl)Phenyl]-2-Hydroxyacetamide](/moreStructures/251366-95-7.gif) |
| Molecular Formula | C9H7F4NO2 |
| Molecular Weight | 237.15 |
| CAS Registry Number | 251366-95-7 |
| SMILES | OC(c1c(cccc1F)C(F)(F)F)C(N)=O |
| InChI | 1S/C9H7F4NO2/c10-5-3-1-2-4(9(11,12)13)6(5)7(15)8(14)16/h1-3,7,15H,(H2,14,16) |
| InChIKey | YHTRBJSDMKDBAZ-UHFFFAOYSA-N |
| Density | 1.491g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.539°C at 760 mmHg (Cal.) |
| Flash point | 148.262°C (Cal.) |
| Refractive index | 1.488 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[2-Fluoro-6-(Trifluoromethyl)Phenyl]-2-Hydroxyacetamide |