Online Database of Chemicals from Around the World
|
CAS#: 25151-33-1 Product: 1-Methyl-1,2-Ethanediyl Diacrylate No suppilers available for the product. |
| Name | 1-Methyl-1,2-Ethanediyl Diacrylate |
|---|---|
| Synonyms | Prop-2-Enoic Acid 2-(1-Oxoprop-2-Enoxy)Propyl Ester; Acrylic Acid 2-Acryloyloxypropyl Ester; 1-Methyl-1,2-Ethanediyl Diacrylate |
| Molecular Structure |  |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 |
| CAS Registry Number | 25151-33-1 |
| EINECS | 246-664-7 |
| SMILES | C(C(OC(C=C)=O)C)OC(C=C)=O |
| InChI | 1S/C9H12O4/c1-4-8(10)12-6-7(3)13-9(11)5-2/h4-5,7H,1-2,6H2,3H3 |
| InChIKey | VFZKVQVQOMDJEG-UHFFFAOYSA-N |
| Density | 1.055g/cm3 (Cal.) |
|---|---|
| Boiling point | 236.458°C at 760 mmHg (Cal.) |
| Flash point | 109.65°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-1,2-Ethanediyl Diacrylate |