Online Database of Chemicals from Around the World
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (732) 355-9920 | |||
 |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 2-Chloroethyl N-(4-Bromophenyl)Carbamate |
|---|---|
| Synonyms | N-(4-Bromophenyl)Carbamic Acid 2-Chloroethyl Ester; Nsc29710 |
| Molecular Structure |  |
| Molecular Formula | C9H9BrClNO2 |
| Molecular Weight | 278.53 |
| CAS Registry Number | 25203-37-6 |
| SMILES | C1=C(C=CC(=C1)Br)NC(OCCCl)=O |
| InChI | 1S/C9H9BrClNO2/c10-7-1-3-8(4-2-7)12-9(13)14-6-5-11/h1-4H,5-6H2,(H,12,13) |
| InChIKey | WIWWEOXZPMCYEG-UHFFFAOYSA-N |
| Density | 1.61g/cm3 (Cal.) |
|---|---|
| Boiling point | 302.36°C at 760 mmHg (Cal.) |
| Flash point | 136.663°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Chloroethyl N-(4-Bromophenyl)Carbamate |