Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Ethyl 3-(3-Aminophenyl)Isonicotinate |
|---|---|
| Synonyms | 3-(3-Aminophenyl)-4-pyridinecarboxylic acid ethyl ester; Ethyl 3-(3-aminophenyl)-4-pyridinecarboxylate |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.27 |
| CAS Registry Number | 252921-31-6 |
| SMILES | O=C(OCC)c2ccncc2c1cc(N)ccc1 |
| InChI | 1S/C14H14N2O2/c1-2-18-14(17)12-6-7-16-9-13(12)10-4-3-5-11(15)8-10/h3-9H,2,15H2,1H3 |
| InChIKey | TWMXELYQVYARBK-UHFFFAOYSA-N |
| Density | 1.184g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.791°C at 760 mmHg (Cal.) |
| Flash point | 225.221°C (Cal.) |
| Refractive index | 1.596 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 3-(3-Aminophenyl)Isonicotinate |