Online Database of Chemicals from Around the World
| C D N Isotopes Inc. | Canada | Inquire | ||
|---|---|---|---|---|
 |
+1 (800) 565-4696 / (514) 697-6254 | |||
 |
info@cdnisotopes.com, | |||
| Chemical manufacturer since 1993 | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+86 (21) 6141-5566 / 800-819-3336 | |||
|
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 1,2-Bis[(2H3)Methyl]Benzene |
|---|---|
| Synonyms | 1,2-bis-trideuteriomethyl-benzene; 1,2-Dimethyl-d6-benzene; Dimethylbenzene |
| Molecular Structure | ![CAS#: 25319-54-4， 1,2-Bis[(<Sup>2</Sup>H<Sub>3</Sub>)Methyl]Benzene](/moreStructures/25319-54-4.gif) |
| Molecular Formula | C8H4D6 |
| Molecular Weight | 112.20 |
| CAS Registry Number | 25319-54-4 |
| SMILES | [2H]C([2H])([2H])c1ccccc1C([2H])([2H])[2H] |
| InChI | 1S/C8H10/c1-7-5-3-4-6-8(7)2/h3-6H,1-2H3/i1D3,2D3 |
| InChIKey | CTQNGGLPUBDAKN-WFGJKAKNSA-N |
| Density | 0.92g/cm3 (Cal.) |
|---|---|
| Boiling point | 145.949°C at 760 mmHg (Cal.) |
| Flash point | 28.882°C (Cal.) |
| Refractive index | 1.5 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Bis[(2H3)Methyl]Benzene |