|
CAS#: 25351-24-0 Product: Gentisuric Acid No suppilers available for the product. |
| Name | Gentisuric Acid |
|---|---|
| Synonyms | 2-[[(2,5-Dihydroxyphenyl)-Oxomethyl]Amino]Acetic Acid; 2-[(2,5-Dihydroxyphenyl)Carbonylamino]Ethanoic Acid; 2,5-Dihydroxybenzoyl-N-Glycine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17 |
| CAS Registry Number | 25351-24-0 |
| SMILES | C1=C(O)C=CC(=C1C(NCC(O)=O)=O)O |
| InChI | 1S/C9H9NO5/c11-5-1-2-7(12)6(3-5)9(15)10-4-8(13)14/h1-3,11-12H,4H2,(H,10,15)(H,13,14) |
| InChIKey | FBFATOOJCPDQOZ-UHFFFAOYSA-N |
| Density | 1.533g/cm3 (Cal.) |
|---|---|
| Boiling point | 530.073°C at 760 mmHg (Cal.) |
| Flash point | 274.379°C (Cal.) |
| (1) | Powers RA, Morandi F, Shoichet BK. Structure-based discovery of a novel, noncovalent inhibitor of AmpC beta-lactamase., Structure. 2002 Jul;10(7):1013-23 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Gentisuric Acid |