Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,4-Bis(1,2-Dibromoethyl)Benzene |
|---|---|
| Synonyms | 3-05-00-00970 (Beilstein Handbook Reference); Brn 1961936 |
| Molecular Structure |  |
| Molecular Formula | C10H10Br4 |
| Molecular Weight | 449.81 |
| CAS Registry Number | 25393-98-0 |
| EINECS | 246-936-5 |
| SMILES | C1=CC(=CC=C1C(CBr)Br)C(CBr)Br |
| InChI | 1S/C10H10Br4/c11-5-9(13)7-1-2-8(4-3-7)10(14)6-12/h1-4,9-10H,5-6H2 |
| InChIKey | KDBQQANTDCVPDZ-UHFFFAOYSA-N |
| Density | 2.149g/cm3 (Cal.) |
|---|---|
| Melting point | 156°C (Expl.) |
| Boiling point | 381.971°C at 760 mmHg (Cal.) |
| Flash point | 179.444°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,4-Bis(1,2-Dibromoethyl)Benzene |