| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 7H-Pyrano[2,3-d]Pyrimidine |
|---|---|
| Synonyms | InChI=1/C7H6N2O/c1-2-6-4-8-5-9-7(6)10-3-1/h1-2,4-5H,3H2; pyrano[2,3-d]pyrimidine |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6N2O |
| Molecular Weight | 134.14 |
| CAS Registry Number | 254-69-3 |
| SMILES | C1C=CC2=CN=CN=C2O1 |
| InChI | 1S/C7H6N2O/c1-2-6-4-8-5-9-7(6)10-3-1/h1-2,4-5H,3H2 |
| InChIKey | HFXRMQZCAIBURX-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 268.6±29.0°C at 760 mmHg (Cal.) |
| Flash point | 98.4±14.5°C (Cal.) |
| Refractive index | 1.584 (Cal.) |
| (1) | Jan Svetlík and Tibor Liptaj. Novel heterocycles containing the pyrazole unit, J. Chem. Soc., Perkin Trans. 1, 2002, 0, 1260. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 7H-Pyrano[2,3-d]Pyrimidine |