Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2-(Ethoxymethyl)-4,6-Dinitrophenol |
|---|---|
| Synonyms | 2-(Ethoxymethyl)-4,6-Dinitro-Phenol; Nsc164627; Phenol, 2-(Ethoxymethyl)-4,6-Dinitro- |
| Molecular Structure |  |
| Molecular Formula | C9H10N2O6 |
| Molecular Weight | 242.19 |
| CAS Registry Number | 2544-94-7 |
| SMILES | C1=C(C(=C(C=C1[N+](=O)[O-])COCC)O)[N+](=O)[O-] |
| InChI | 1S/C9H10N2O6/c1-2-17-5-6-3-7(10(13)14)4-8(9(6)12)11(15)16/h3-4,12H,2,5H2,1H3 |
| InChIKey | DSABESMCWFGGNQ-UHFFFAOYSA-N |
| Density | 1.448g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.769°C at 760 mmHg (Cal.) |
| Flash point | 176.221°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-(Ethoxymethyl)-4,6-Dinitrophenol |