Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 3-(Phenylsulfonyl)-Benzoic Acid |
|---|---|
| Synonyms | Nsc 43055; 3-(Phenylsulfonyl)Benzoic Acid; Aids-124649 |
| Molecular Structure |  |
| Molecular Formula | C13H10O4S |
| Molecular Weight | 262.28 |
| CAS Registry Number | 2548-44-9 |
| SMILES | C1=CC=C(C=C1C(O)=O)[S](=O)(=O)C2=CC=CC=C2 |
| InChI | 1S/C13H10O4S/c14-13(15)10-5-4-8-12(9-10)18(16,17)11-6-2-1-3-7-11/h1-9H,(H,14,15) |
| InChIKey | MAVYXMCSVGUDEZ-UHFFFAOYSA-N |
| Density | 1.378g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.434°C at 760 mmHg (Cal.) |
| Flash point | 260.082°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Phenylsulfonyl)-Benzoic Acid |