Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | cis-(1S,2R)-3-Methyl-3,5-Cyclohexadiene-1,2- Diol |
|---|---|
| Synonyms | C0283; Zinc01530005 |
| Molecular Structure |  |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 |
| CAS Registry Number | 25506-13-2 |
| SMILES | [C@@H]1(C(=CC=C[C@H]1O)C)O |
| InChI | 1S/C7H10O2/c1-5-3-2-4-6(8)7(5)9/h2-4,6-9H,1H3/t6-,7+/m1/s1 |
| InChIKey | FTZZKLFGNQOODA-RQJHMYQMSA-N |
| Density | 1.201g/cm3 (Cal.) |
|---|---|
| Boiling point | 234.324°C at 760 mmHg (Cal.) |
| Flash point | 111.386°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for cis-(1S,2R)-3-Methyl-3,5-Cyclohexadiene-1,2- Diol |