Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Matrix Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (803) 788-9494 | |||
|
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Name | 3-Acetyl-2-Hydroxychromen-4-One |
|---|---|
| Synonyms | 3-Acetyl-2-Hydroxy-Chromen-4-One; 3-Acetyl-2-Hydroxy-4-Chromenone; 3-Acetyl-2-Hydroxy-Chromone |
| Molecular Structure |  |
| Molecular Formula | C11H8O4 |
| Molecular Weight | 204.18 |
| CAS Registry Number | 2555-37-5 |
| EINECS | 219-866-8 |
| SMILES | C1=C2C(=CC=C1)OC(=C(C2=O)C(=O)C)O |
| InChI | 1S/C11H8O4/c1-6(12)9-10(13)7-4-2-3-5-8(7)15-11(9)14/h2-5,14H,1H3 |
| InChIKey | XMHWONVKUWFJKW-UHFFFAOYSA-N |
| Density | 1.445g/cm3 (Cal.) |
|---|---|
| Boiling point | 342.593°C at 760 mmHg (Cal.) |
| Flash point | 137.069°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-Acetyl-2-Hydroxychromen-4-One |