| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-Propenoic acid polymer with ethenylbenzene and ethyl 2-propenoate |
|---|---|
| Synonyms | Acrylic Acid; Ethyl Prop-2-Enoate; Styrene; Acrylic Acid; Prop-2-Enoic Acid Ethyl Ester; Styrene |
| Molecular Structure | ![]() |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 |
| CAS Registry Number | 25585-77-7 |
| SMILES | C(OC(=O)C=C)C.O=C(O)C=C.C1=C(C=CC=C1)C=C |
| InChI | 1S/C8H8.C5H8O2.C3H4O2/c1-2-8-6-4-3-5-7-8;1-3-5(6)7-4-2;1-2-3(4)5/h2-7H,1H2;3H,1,4H2,2H3;2H,1H2,(H,4,5) |
| InChIKey | JESHXKDBDWGKKZ-UHFFFAOYSA-N |
| Boiling point | 145.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 31.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Propenoic acid polymer with ethenylbenzene and ethyl 2-propenoate |