| Shanghai Worldyang Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.worldyachem.com | |||
![]() | +86 13651600618 +86 (21) 5679-5779 | |||
![]() | +86 (21) 5679-5266 | |||
![]() | sales7777@worldyachem.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 13651600618 | |||
![]() | WhatsApp:+86 13651600618 | |||
| Chemical manufacturer since 2012 | ||||
| Name | 1,2-Bis(dichloromethyl)benzene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C8H6Cl4 |
| Molecular Weight | 243.95 |
| CAS Registry Number | 25641-99-0 |
| EC Number | 247-159-4 |
| SMILES | C1=CC=C(C(=C1)C(Cl)Cl)C(Cl)Cl |
| Solubility | 10.68 mg/L (25 °C water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.570, Calc.* |
| Melting point | 44.41 °C |
| Boiling Point | 286.17 °C, 294.6±35.0 °C (760 mmHg), Calc.* |
| Flash Point | 134.3±23.3 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H315-H319-H335 Details | ||||||||||||||||||||||||||||||||
| Safety Statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P362-P403+P233-P405-P501 Details | ||||||||||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 1,2-Bis(dichloromethyl)benzene |