Online Database of Chemicals from Around the World

tert-Butyl (R)-3-((S)-1-(tert-butoxy)-3-(3-hydroxyphenyl)-1-oxopropan-2-yl)pyrrolidine-1-carboxylate
[CAS 2565657-83-0]

List of Suppliers
Abosyn Chemicals Inc. USA
www.abosyn.com
+1 (203) 683-8328
info@abosyn.com
Chemical manufacturer since 2014
chemBlink Standard supplier since 2025

Identification
ClassificationOrganic raw materials >> Carboxylic compounds and derivatives >> Carboxylic esters and their derivatives
Nametert-Butyl (R)-3-((S)-1-(tert-butoxy)-3-(3-hydroxyphenyl)-1-oxopropan-2-yl)pyrrolidine-1-carboxylate
Synonyms tert-butyl (3R)-3-[(1S)-2-tert-butoxy-1-[(3-hydroxyphenyl)methyl]-2-oxo-ethyl]pyrrolidine-1-carboxylate
Molecular Structuretert-Butyl (R)-3-((S)-1-(tert-butoxy)-3-(3-hydroxyphenyl)-1-oxopropan-2-yl)pyrrolidine-1-carboxylate molecular structure (CAS 2565657-83-0)
Molecular FormulaC22H33NO5
Molecular Weight391.50
CAS Registry Number2565657-83-0
SMILESO=C(OC(C)(C)C)N(CC1)C[C@H]1[C@H](CC2=CC=CC(O)=C2)C(OC(C)(C)C)=O
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH315-H319-H335  Details
Safety StatementsP261-P305+P351+P338-P302+P352  Details
SDSAvailable
up Discovery and Applications
tert-Butyl (R)-3-((S)-1-(tert-butoxy)-3-(3-hydroxyphenyl)-1-oxopropan-2-yl)pyrrolidine-1-carboxylate is a chemical compound that falls within the class of pyrrolidine derivatives, which are often studied for their potential therapeutic properties. It is a chiral molecule, containing both (R)- and (S)-configured stereocenters, which can impart distinct biological activities depending on the specific configuration of the molecule. This compound contains a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and various functional groups including a tert-butoxy group, a hydroxyphenyl group, and an oxopropan-2-yl moiety, all of which contribute to its chemical and biological characteristics.

The discovery of this chemical compound likely arose from efforts in the field of medicinal chemistry, where researchers design and synthesize complex organic molecules with the goal of finding new pharmacological agents. Pyrrolidine derivatives like this one are of particular interest due to their structural versatility and potential applications in drug design. This molecule is often synthesized through specific reactions that involve chiral resolution to produce the (R)- and (S)-enantiomers, which can exhibit different pharmacological properties.

This compound has been studied primarily for its potential use in medicinal chemistry, specifically in the development of drugs targeting various biological systems. The presence of the hydroxyphenyl group, combined with the chiral pyrrolidine ring, suggests that this compound could interact with biological receptors or enzymes in a way that modulates specific cellular functions. The hydroxyphenyl group could be involved in aromatic stacking interactions, which are important in the binding of molecules to protein targets.

The presence of the tert-butoxy group and the oxopropan-2-yl moiety also suggests that the compound could be designed for increased solubility and stability, which are key factors in the development of drug-like molecules. These structural features likely make the compound a candidate for further biological testing to assess its effectiveness in modulating specific protein functions or cellular processes. It could potentially be investigated for its role in inhibiting or promoting specific enzymes or receptors involved in diseases such as cancer, neurodegenerative diseases, or metabolic disorders.

Although the precise therapeutic application of this specific compound has not been widely reported, compounds with similar structures have shown promise in a range of biomedical applications. Researchers continue to investigate the potential of pyrrolidine-based molecules, especially those with complex substituents like hydroxyphenyl groups, in targeting various biological pathways. Furthermore, the ability to control stereochemistry in the synthesis of such compounds is a key feature in developing molecules with enhanced selectivity and reduced side effects.

In summary, tert-Butyl (R)-3-((S)-1-(tert-butoxy)-3-(3-hydroxyphenyl)-1-oxopropan-2-yl)pyrrolidine-1-carboxylate is a chiral pyrrolidine derivative that holds potential for medicinal chemistry research, particularly in the design and development of therapeutic agents. Its complex structure, with various functional groups, suggests that it may interact with biological systems in a specific and useful way. Ongoing research will likely continue to explore the compound's pharmacological properties and its potential in the development of new drugs.
Market Analysis Reports
Related Products
Tert-butyl (8-s...  (S)-(-)-Tert-Bu...  tert-Butyl 2-(t...  tert-Butyl 2-(t...  tert-Butyl 2-(t...  tert-Butyl 2-(t...  (R)-tert-Butyl ...  tert-Butyl (3R)...  4-tert-Butyl N-...  tert-Butyl (ter...  tert-butyl (S)-...  4-Tert-Butyl-2-...  5-Tert-Butyl-2-...  5-tert-Butyl-2-...  tert-Butyl ((2S...  Tert-Butyl (3S)...  2-[2-Tert-Butyl...  tert-Butyl 2-(t...  (S)-tert-Butyl ...  (S)-tert-Butyl ...