| Classification | Biochemical >> Amino acids and their derivatives >> Tyrosine derivatives |
|---|---|
| Name | (2S)-2-(Benzoylamino)-3-(4-Hydroxyphenyl)Propanoic Acid |
| Synonyms | (2S)-3-(4-Hydroxyphenyl)-2-[(Oxo-Phenylmethyl)Amino]Propanoic Acid; (2S)-2-(Benzoylamino)-3-(4-Hydroxyphenyl)Propionic Acid; (2S)-3-(4-Hydroxyphenyl)-2-(Phenylcarbonylamino)Propanoic Acid |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 |
| CAS Registry Number | 2566-23-6 |
| SMILES | [C@H](C(=O)O)(NC(C1=CC=CC=C1)=O)CC2=CC=C(O)C=C2 |
| InChI | 1S/C16H15NO4/c18-13-8-6-11(7-9-13)10-14(16(20)21)17-15(19)12-4-2-1-3-5-12/h1-9,14,18H,10H2,(H,17,19)(H,20,21)/t14-/m0/s1 |
| InChIKey | KUUUDPTUEOKITK-AWEZNQCLSA-N |
| Density | 1.315g/cm3 (Cal.) |
|---|---|
| Boiling point | 598.158°C at 760 mmHg (Cal.) |
| Flash point | 315.555°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (2S)-2-(Benzoylamino)-3-(4-Hydroxyphenyl)Propanoic Acid |